C15H14F5N9O2 — CID 156756520
N-(1-methyltetrazol-5-yl)-2-[(1-methyl-1,2,4-triazol-3-yl)methoxymethyl]-6-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxamide (PubChem CID 156756520) has the molecular formula C15H14F5N9O2 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-(1-methyltetrazol-5-yl)-2-[(1-methyl-1,2,4-triazol-3-yl)methoxymethyl]-6-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-(1-methyltetrazol-5-yl)-2-[(1-methyl-1,2,4-triazol-3-yl)methoxymethyl]-6-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156756520 |
| Molecular Formula | C15H14F5N9O2 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-(1-methyltetrazol-5-yl)-2-[(1-methyl-1,2,4-triazol-3-yl)methoxymethyl]-6-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxamide |
| SMILES | Cn1cnc(COCc2nc(C(F)(F)C(F)(F)F)ccc2C(=O)Nc2nnnn2C)n1 |
| InChI | InChI=1S/C15H14F5N9O2/c1-28-7-21-11(25-28)6-31-5-9-8(12(30)23-13-24-26-27-29(13)2)3-4-10(22-9)14(16,17)15(18,19)20/h3-4,7H,5-6H2,1-2H3,(H,23,24,27,30) |
| InChIKey | WRLUIQJNDJZLFT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|