C20H23NO3 — CID 156758161
7a-(2-methyl-4-phenylmethoxybutyl)-3aH-isoindole-1,3-dione (PubChem CID 156758161) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 7a-(2-methyl-4-phenylmethoxybutyl)-3aH-isoindole-1,3-dione.
| Compound Name | 7a-(2-methyl-4-phenylmethoxybutyl)-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 156758161 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 7a-(2-methyl-4-phenylmethoxybutyl)-3aH-isoindole-1,3-dione |
| SMILES | CC(CCOCc1ccccc1)CC12C=CC=CC1C(=O)NC2=O |
| InChI | InChI=1S/C20H23NO3/c1-15(10-12-24-14-16-7-3-2-4-8-16)13-20-11-6-5-9-17(20)18(22)21-19(20)23/h2-9,11,15,17H,10,12-14H2,1H3,(H,21,22,23) |
| InChIKey | FHUWPUGXGAFAIA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|