C26H36N8O2 — CID 156758636
(E)-N-[4-(dimethylamino)-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]but-2-enamide (PubChem CID 156758636) has the molecular formula C26H36N8O2 and a molecular weight of 492.63 g/mol. Its IUPAC name is (E)-N-[4-(dimethylamino)-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]but-2-enamide.
| Compound Name | (E)-N-[4-(dimethylamino)-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 156758636 |
| Molecular Formula | C26H36N8O2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | (E)-N-[4-(dimethylamino)-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(N(C)C)c(CNc2nc(NC3CCOCC3)nc3c(C(C)C)cnn23)c1 |
| InChI | InChI=1S/C26H36N8O2/c1-6-7-23(35)29-20-8-9-22(33(4)5)18(14-20)15-27-26-32-25(30-19-10-12-36-13-11-19)31-24-21(17(2)3)16-28-34(24)26/h6-9,14,16-17,19H,10-13,15H2,1-5H3,(H,29,35)(H2,27,30,31,32)/b7-6+ |
| InChIKey | CYVJIJLVNFJMDP-VOTSOKGWSA-N |
| XLogP | 4.03 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|