C32H45N7O2 — CID 167536921
buta-1,3-diene;2-[4-methyl-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-piperidin-2-ylethanone (PubChem CID 167536921) has the molecular formula C32H45N7O2 and a molecular weight of 559.76 g/mol. Its IUPAC name is buta-1,3-diene;2-[4-methyl-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-piperidin-2-ylethanone.
| Compound Name | buta-1,3-diene;2-[4-methyl-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-piperidin-2-ylethanone |
|---|---|
| PubChem CID | 167536921 |
| Molecular Formula | C32H45N7O2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.36 |
| IUPAC Name | buta-1,3-diene;2-[4-methyl-3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-piperidin-2-ylethanone |
| SMILES | C=CC=C.Cc1ccc(CC(=O)C2CCCCN2)cc1CNc1nc(NC2CCOCC2)nc2c(C(C)C)cnn12 |
| InChI | InChI=1S/C28H39N7O2.C4H6/c1-18(2)23-17-31-35-26(23)33-27(32-22-9-12-37-13-10-22)34-28(35)30-16-21-14-20(8-7-19(21)3)15-25(36)24-6-4-5-11-29-24;1-3-4-2/h7-8,14,17-18,22,24,29H,4-6,9-13,15-16H2,1-3H3,(H2,30,32,33,34);3-4H,1-2H2 |
| InChIKey | ARGQEZLYRPNGRA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|