C27H33N9O2 — CID 145151029
3-[(1E)-buta-1,3-dienyl]imino-2-imino-N-[3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]propanamide (PubChem CID 145151029) has the molecular formula C27H33N9O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 3-[(1E)-buta-1,3-dienyl]imino-2-imino-N-[3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]propanamide.
| Compound Name | 3-[(1E)-buta-1,3-dienyl]imino-2-imino-N-[3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 145151029 |
| Molecular Formula | C27H33N9O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 3-[(1E)-buta-1,3-dienyl]imino-2-imino-N-[3-[[[2-(oxan-4-ylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]propanamide |
| SMILES | [H]/N=C(\C=N\C=C\C=C)C(=O)Nc1cccc(CNc2nc(NC3CCOCC3)nc3c(C(C)C)cnn23)c1 |
| InChI | InChI=1S/C27H33N9O2/c1-4-5-11-29-17-23(28)25(37)32-21-8-6-7-19(14-21)15-30-27-35-26(33-20-9-12-38-13-10-20)34-24-22(18(2)3)16-31-36(24)27/h4-8,11,14,16-18,20,28H,1,9-10,12-13,15H2,2-3H3,(H,32,37)(H2,30,33,34,35)/b11-5+,28-23+,29-17+ |
| InChIKey | RVFTZNVALUCQBJ-BIPAVRNMSA-N |
| XLogP | 4.18 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|