C25H34N8O — CID 170599228
N-[3-[[[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 170599228) has the molecular formula C25H34N8O and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[3-[[[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170599228 |
| Molecular Formula | C25H34N8O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[3-[[[2-[[(3S)-6,6-dimethylpiperidin-3-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(N[C@H]3CCC(C)(C)NC3)nc3c(C(C)C)cnn23)c1 |
| InChI | InChI=1S/C25H34N8O/c1-6-21(34)29-18-9-7-8-17(12-18)13-26-24-32-23(30-19-10-11-25(4,5)27-14-19)31-22-20(16(2)3)15-28-33(22)24/h6-9,12,15-16,19,27H,1,10-11,13-14H2,2-5H3,(H,29,34)(H2,26,30,31,32)/t19-/m0/s1 |
| InChIKey | ONVGBFLUIKXSCS-IBGZPJMESA-N |
| XLogP | 3.93 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|