C26H36N8 — CID 140938859
4-N-[[3-(buta-1,3-dien-2-ylamino)phenyl]methyl]-2-N-[4-(dimethylamino)cyclohexyl]-8-ethylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine (PubChem CID 140938859) has the molecular formula C26H36N8 and a molecular weight of 460.63 g/mol. Its IUPAC name is 4-N-[[3-(buta-1,3-dien-2-ylamino)phenyl]methyl]-2-N-[4-(dimethylamino)cyclohexyl]-8-ethylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine.
| Compound Name | 4-N-[[3-(buta-1,3-dien-2-ylamino)phenyl]methyl]-2-N-[4-(dimethylamino)cyclohexyl]-8-ethylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
|---|---|
| PubChem CID | 140938859 |
| Molecular Formula | C26H36N8 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 4-N-[[3-(buta-1,3-dien-2-ylamino)phenyl]methyl]-2-N-[4-(dimethylamino)cyclohexyl]-8-ethylpyrazolo[1,5-a][1,3,5]triazine-2,4-diamine |
| SMILES | C=CC(=C)Nc1cccc(CNc2nc(NC3CCC(N(C)C)CC3)nc3c(CC)cnn23)c1 |
| InChI | InChI=1S/C26H36N8/c1-6-18(3)29-22-10-8-9-19(15-22)16-27-26-32-25(31-24-20(7-2)17-28-34(24)26)30-21-11-13-23(14-12-21)33(4)5/h6,8-10,15,17,21,23,29H,1,3,7,11-14,16H2,2,4-5H3,(H2,27,30,31,32) |
| InChIKey | FEWNSPZHAQIQJP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|