C33H41N9O — CID 161376803
4-(buta-1,3-dien-2-ylamino)-N-[3-[[2-[[4-(dimethylamino)cyclohexyl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]benzamide (PubChem CID 161376803) has the molecular formula C33H41N9O and a molecular weight of 579.75 g/mol. Its IUPAC name is 4-(buta-1,3-dien-2-ylamino)-N-[3-[[2-[[4-(dimethylamino)cyclohexyl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]benzamide.
| Compound Name | 4-(buta-1,3-dien-2-ylamino)-N-[3-[[2-[[4-(dimethylamino)cyclohexyl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 161376803 |
| Molecular Formula | C33H41N9O |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | 4-(buta-1,3-dien-2-ylamino)-N-[3-[[2-[[4-(dimethylamino)cyclohexyl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]benzamide |
| SMILES | C=CC(=C)Nc1ccc(C(=O)Nc2cccc(Nc3nc(NC4CCC(N(C)C)CC4)nc4c(C(C)C)cnn34)c2)cc1 |
| InChI | InChI=1S/C33H41N9O/c1-7-22(4)35-24-13-11-23(12-14-24)31(43)36-26-9-8-10-27(19-26)38-33-40-32(37-25-15-17-28(18-16-25)41(5)6)39-30-29(21(2)3)20-34-42(30)33/h7-14,19-21,25,28,35H,1,4,15-18H2,2-3,5-6H3,(H,36,43)(H2,37,38,39,40) |
| InChIKey | PLXPSPCSNKNQEK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|