C18H20N6O — CID 145163977
N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]prop-2-enamide (PubChem CID 145163977) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 145163977 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2cc(N)nc3c(C(C)C)cnn23)c1 |
| InChI | InChI=1S/C18H20N6O/c1-4-17(25)22-13-7-5-6-12(8-13)21-16-9-15(19)23-18-14(11(2)3)10-20-24(16)18/h4-11,21H,1H2,2-3H3,(H2,19,23)(H,22,25) |
| InChIKey | IFPNCYOHKMKLRN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|