C17H21ClN5O2S+ — CID 142947005
CID 142947005 (PubChem CID 142947005) has the molecular formula C17H21ClN5O2S+ and a molecular weight of 394.91 g/mol.
| Compound Name | CID 142947005 |
|---|---|
| PubChem CID | 142947005 |
| Molecular Formula | C17H21ClN5O2S+ |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | — |
| SMILES | CC(C)c1cnn2c(Nc3ccc([S+](=O)(O)N(C)C)cc3)cc(Cl)nc12 |
| InChI | InChI=1S/C17H20ClN5O2S/c1-11(2)14-10-19-23-16(9-15(18)21-17(14)23)20-12-5-7-13(8-6-12)26(24,25)22(3)4/h5-11,20H,1-4H3/p+1 |
| InChIKey | MVWYENKXNTVRJH-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|