C16H16ClN5O2 — CID 170358411
(3-aminophenyl)-(5-chloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid (PubChem CID 170358411) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is (3-aminophenyl)-(5-chloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid.
| Compound Name | (3-aminophenyl)-(5-chloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid |
|---|---|
| PubChem CID | 170358411 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3-aminophenyl)-(5-chloro-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid |
| SMILES | CC(C)c1cnn2c(N(C(=O)O)c3cccc(N)c3)cc(Cl)nc12 |
| InChI | InChI=1S/C16H16ClN5O2/c1-9(2)12-8-19-22-14(7-13(17)20-15(12)22)21(16(23)24)11-5-3-4-10(18)6-11/h3-9H,18H2,1-2H3,(H,23,24) |
| InChIKey | OJBINHQPFFWEPS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|