C21H29N7O — CID 122536987
4-[[4-[(3-aminophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]cyclohexan-1-ol (PubChem CID 122536987) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[[4-[(3-aminophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[4-[(3-aminophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 122536987 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-[[4-[(3-aminophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC(C)c1cnn2c(NCc3cccc(N)c3)nc(NC3CCC(O)CC3)nc12 |
| InChI | InChI=1S/C21H29N7O/c1-13(2)18-12-24-28-19(18)26-20(25-16-6-8-17(29)9-7-16)27-21(28)23-11-14-4-3-5-15(22)10-14/h3-5,10,12-13,16-17,29H,6-9,11,22H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | PIXOWLDSIARRCM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|