C22H30N8O3 — CID 170599179
(3R,4R)-1-methyl-4-[[[4-[(3-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]methyl]piperidin-3-ol (PubChem CID 170599179) has the molecular formula C22H30N8O3 and a molecular weight of 454.54 g/mol. Its IUPAC name is (3R,4R)-1-methyl-4-[[[4-[(3-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-1-methyl-4-[[[4-[(3-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 170599179 |
| Molecular Formula | C22H30N8O3 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (3R,4R)-1-methyl-4-[[[4-[(3-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]methyl]piperidin-3-ol |
| SMILES | CC(C)c1cnn2c(NCc3cccc([N+](=O)[O-])c3)nc(NC[C@H]3CCN(C)C[C@@H]3O)nc12 |
| InChI | InChI=1S/C22H30N8O3/c1-14(2)18-12-25-29-20(18)26-21(23-11-16-7-8-28(3)13-19(16)31)27-22(29)24-10-15-5-4-6-17(9-15)30(32)33/h4-6,9,12,14,16,19,31H,7-8,10-11,13H2,1-3H3,(H2,23,24,26,27)/t16-,19+/m1/s1 |
| InChIKey | WEFHSCTWFNHYPU-APWZRJJASA-N |
| XLogP | 2.49 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|