C27H37ClN8O4 — CID 170358327
tert-butyl 5-[[4-[(2-chloro-5-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2,2-dimethylpiperidine-1-carboxylate (PubChem CID 170358327) has the molecular formula C27H37ClN8O4 and a molecular weight of 573.10 g/mol. Its IUPAC name is tert-butyl 5-[[4-[(2-chloro-5-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2,2-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 5-[[4-[(2-chloro-5-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2,2-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170358327 |
| Molecular Formula | C27H37ClN8O4 |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | tert-butyl 5-[[4-[(2-chloro-5-nitrophenyl)methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]-2,2-dimethylpiperidine-1-carboxylate |
| SMILES | CC(C)c1cnn2c(NCc3cc([N+](=O)[O-])ccc3Cl)nc(NC3CCC(C)(C)N(C(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C27H37ClN8O4/c1-16(2)20-14-30-35-22(20)32-23(33-24(35)29-13-17-12-19(36(38)39)8-9-21(17)28)31-18-10-11-27(6,7)34(15-18)25(37)40-26(3,4)5/h8-9,12,14,16,18H,10-11,13,15H2,1-7H3,(H2,29,31,32,33) |
| InChIKey | CHALXPGRZDJOBE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|