C16H17ClN6O4S — CID 170599174
N-[(2-chloro-5-nitrophenyl)methyl]-2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 170599174) has the molecular formula C16H17ClN6O4S and a molecular weight of 424.87 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 170599174 |
| Molecular Formula | C16H17ClN6O4S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-2-methylsulfonyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CC(C)c1cnn2c(NCc3cc([N+](=O)[O-])ccc3Cl)nc(S(C)(=O)=O)nc12 |
| InChI | InChI=1S/C16H17ClN6O4S/c1-9(2)12-8-19-22-14(12)20-16(28(3,26)27)21-15(22)18-7-10-6-11(23(24)25)4-5-13(10)17/h4-6,8-9H,7H2,1-3H3,(H,18,20,21) |
| InChIKey | YBGHDDLVAQEIRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|