About 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine
3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 122457230) has the molecular formula C7H6Cl2N4
and a molecular weight of 217.06 g/mol. Its IUPAC name is 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine.
Analyze 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine (CID 122457230) is 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine is CNc1cc(Cl)nc2c(Cl)cnn12.
What is the InChIKey of 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is GBGHUUCOPRVDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N4/c1-10-6-2-5(9)12-7-4(8)3-11-13(6)7/h2-3,10H,1H3.
What are the key properties of 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine?
3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 217.06 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-methylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 122457230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).