C7H5Cl2N3 — CID 58083235
4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine (PubChem CID 58083235) has the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. Its IUPAC name is 4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine.
| Compound Name | 4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 58083235 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 4,6-dichloro-1-methylpyrazolo[5,4-b]pyridine |
| SMILES | Cn1ncc2c(Cl)cc(Cl)nc21 |
| InChI | InChI=1S/C7H5Cl2N3/c1-12-7-4(3-10-12)5(8)2-6(9)11-7/h2-3H,1H3 |
| InChIKey | FNIWVSATLMFMHJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|