C25H25N7O2 — CID 146180336
N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]-4-(prop-2-enoylamino)benzamide (PubChem CID 146180336) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]-4-(prop-2-enoylamino)benzamide.
| Compound Name | N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]-4-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 146180336 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[3-[(5-amino-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]-4-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Nc2cccc(Nc3cc(N)nc4c(C(C)C)cnn34)c2)cc1 |
| InChI | InChI=1S/C25H25N7O2/c1-4-23(33)29-17-10-8-16(9-11-17)25(34)30-19-7-5-6-18(12-19)28-22-13-21(26)31-24-20(15(2)3)14-27-32(22)24/h4-15,28H,1H2,2-3H3,(H2,26,31)(H,29,33)(H,30,34) |
| InChIKey | CHTRLKRGELLPCN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 126.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|