C32H32F3N9O — CID 169186885
N-[1-[2-[[[2-[(6,6-dimethylpiperidin-3-yl)amino]-8-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]prop-2-enamide (PubChem CID 169186885) has the molecular formula C32H32F3N9O and a molecular weight of 615.66 g/mol. Its IUPAC name is N-[1-[2-[[[2-[(6,6-dimethylpiperidin-3-yl)amino]-8-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]prop-2-enamide.
| Compound Name | N-[1-[2-[[[2-[(6,6-dimethylpiperidin-3-yl)amino]-8-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 169186885 |
| Molecular Formula | C32H32F3N9O |
| Molecular Weight | 615.66 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | N-[1-[2-[[[2-[(6,6-dimethylpiperidin-3-yl)amino]-8-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(-c3ccccc3CNc3nc(NC4CCC(C)(C)NC4)nc4c(C(F)(F)F)cnn34)nccc2c1 |
| InChI | InChI=1S/C32H32F3N9O/c1-4-26(45)40-21-9-10-24-19(15-21)12-14-36-27(24)23-8-6-5-7-20(23)16-37-30-43-29(41-22-11-13-31(2,3)38-17-22)42-28-25(32(33,34)35)18-39-44(28)30/h4-10,12,14-15,18,22,38H,1,11,13,16-17H2,2-3H3,(H,40,45)(H2,37,41,42,43) |
| InChIKey | KQZINWGPFQZWGJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|