C23H22FN5O2 — CID 156759601
N-[5-[5-ethoxy-2-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide (PubChem CID 156759601) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is N-[5-[5-ethoxy-2-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[5-ethoxy-2-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759601 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[5-[5-ethoxy-2-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3cnn(C)c3)[nH]c3ncc(OCC)cc23)cc(F)c1C |
| InChI | InChI=1S/C23H22FN5O2/c1-5-20(30)27-19-8-14(7-18(24)13(19)3)21-17-9-16(31-6-2)11-25-23(17)28-22(21)15-10-26-29(4)12-15/h5,7-12H,1,6H2,2-4H3,(H,25,28)(H,27,30) |
| InChIKey | ORUCSIZUPDZBEZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|