C21H28FNO4 — CID 156760214
N-cyclobutyl-6-fluoro-7-(3-methoxypropoxy)-2-(3-methyloxetan-3-yl)-2H-chromen-4-amine (PubChem CID 156760214) has the molecular formula C21H28FNO4 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-cyclobutyl-6-fluoro-7-(3-methoxypropoxy)-2-(3-methyloxetan-3-yl)-2H-chromen-4-amine.
| Compound Name | N-cyclobutyl-6-fluoro-7-(3-methoxypropoxy)-2-(3-methyloxetan-3-yl)-2H-chromen-4-amine |
|---|---|
| PubChem CID | 156760214 |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-cyclobutyl-6-fluoro-7-(3-methoxypropoxy)-2-(3-methyloxetan-3-yl)-2H-chromen-4-amine |
| SMILES | COCCCOc1cc2c(cc1F)C(NC1CCC1)=CC(C1(C)COC1)O2 |
| InChI | InChI=1S/C21H28FNO4/c1-21(12-25-13-21)20-10-17(23-14-5-3-6-14)15-9-16(22)19(11-18(15)27-20)26-8-4-7-24-2/h9-11,14,20,23H,3-8,12-13H2,1-2H3 |
| InChIKey | SRLBLZBHQWLXKV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|