C16H21FO5S — CID 155339799
6-fluoro-7-(3-methoxypropoxy)-1,1-dioxo-2-propan-2-yl-2,3-dihydrothiochromen-4-one (PubChem CID 155339799) has the molecular formula C16H21FO5S and a molecular weight of 344.40 g/mol. Its IUPAC name is 6-fluoro-7-(3-methoxypropoxy)-1,1-dioxo-2-propan-2-yl-2,3-dihydrothiochromen-4-one.
| Compound Name | 6-fluoro-7-(3-methoxypropoxy)-1,1-dioxo-2-propan-2-yl-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 155339799 |
| Molecular Formula | C16H21FO5S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 6-fluoro-7-(3-methoxypropoxy)-1,1-dioxo-2-propan-2-yl-2,3-dihydrothiochromen-4-one |
| SMILES | COCCCOc1cc2c(cc1F)C(=O)CC(C(C)C)S2(=O)=O |
| InChI | InChI=1S/C16H21FO5S/c1-10(2)15-8-13(18)11-7-12(17)14(22-6-4-5-21-3)9-16(11)23(15,19)20/h7,9-10,15H,4-6,8H2,1-3H3 |
| InChIKey | UJLWNEDQFILSBJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|