C17H25NO2 — CID 123339931
6-(3-methoxypropoxy)-7-methyl-3-propan-2-yl-3,4-dihydroisoquinoline (PubChem CID 123339931) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 6-(3-methoxypropoxy)-7-methyl-3-propan-2-yl-3,4-dihydroisoquinoline.
| Compound Name | 6-(3-methoxypropoxy)-7-methyl-3-propan-2-yl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 123339931 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 6-(3-methoxypropoxy)-7-methyl-3-propan-2-yl-3,4-dihydroisoquinoline |
| SMILES | COCCCOc1cc2c(cc1C)C=NC(C(C)C)C2 |
| InChI | InChI=1S/C17H25NO2/c1-12(2)16-9-14-10-17(20-7-5-6-19-4)13(3)8-15(14)11-18-16/h8,10-12,16H,5-7,9H2,1-4H3 |
| InChIKey | FFDCJYASWZUMQL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|