C17H22F3NO3 — CID 118279093
6-(3-ethoxypropoxy)-7-methoxy-3-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline (PubChem CID 118279093) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 6-(3-ethoxypropoxy)-7-methoxy-3-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline.
| Compound Name | 6-(3-ethoxypropoxy)-7-methoxy-3-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 118279093 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 6-(3-ethoxypropoxy)-7-methoxy-3-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinoline |
| SMILES | CCOCCCOc1cc2c(cc1OC)C=NC(CC(F)(F)F)C2 |
| InChI | InChI=1S/C17H22F3NO3/c1-3-23-5-4-6-24-16-8-12-7-14(10-17(18,19)20)21-11-13(12)9-15(16)22-2/h8-9,11,14H,3-7,10H2,1-2H3 |
| InChIKey | XGIBHBPSPQLXFX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|