C17H12F7N5O5S2 — CID 156760502
[5-fluoro-3-[1-[3-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridin-5-yl]pyrrolidin-2-yl]-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 156760502) has the molecular formula C17H12F7N5O5S2 and a molecular weight of 563.43 g/mol. Its IUPAC name is [5-fluoro-3-[1-[3-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridin-5-yl]pyrrolidin-2-yl]-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [5-fluoro-3-[1-[3-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridin-5-yl]pyrrolidin-2-yl]-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156760502 |
| Molecular Formula | C17H12F7N5O5S2 |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | [5-fluoro-3-[1-[3-(trifluoromethylsulfonyl)imidazo[4,5-b]pyridin-5-yl]pyrrolidin-2-yl]-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ncc(F)cc1C1CCCN1c1ccc2ncn(S(=O)(=O)C(F)(F)F)c2n1)C(F)(F)F |
| InChI | InChI=1S/C17H12F7N5O5S2/c18-9-6-10(15(25-7-9)34-36(32,33)17(22,23)24)12-2-1-5-28(12)13-4-3-11-14(27-13)29(8-26-11)35(30,31)16(19,20)21/h3-4,6-8,12H,1-2,5H2 |
| InChIKey | WCSUXJVBZKQNAU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 124.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|