C17H15NO7 — CID 156760560
3-[[[3-(carboxymethyl)-2,5-dihydroxybenzoyl]amino]methyl]benzoic acid (PubChem CID 156760560) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is 3-[[[3-(carboxymethyl)-2,5-dihydroxybenzoyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[3-(carboxymethyl)-2,5-dihydroxybenzoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 156760560 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 3-[[[3-(carboxymethyl)-2,5-dihydroxybenzoyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)Cc1cc(O)cc(C(=O)NCc2cccc(C(=O)O)c2)c1O |
| InChI | InChI=1S/C17H15NO7/c19-12-5-11(6-14(20)21)15(22)13(7-12)16(23)18-8-9-2-1-3-10(4-9)17(24)25/h1-5,7,19,22H,6,8H2,(H,18,23)(H,20,21)(H,24,25) |
| InChIKey | VBDVGEGKTKOBIQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|