C18H18N2O7 — CID 156760612
ethyl 3-[(4-ethoxycarbonyl-2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylate (PubChem CID 156760612) has the molecular formula C18H18N2O7 and a molecular weight of 374.35 g/mol. Its IUPAC name is ethyl 3-[(4-ethoxycarbonyl-2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylate.
| Compound Name | ethyl 3-[(4-ethoxycarbonyl-2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 156760612 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 3-[(4-ethoxycarbonyl-2,5-dihydroxybenzoyl)amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(O)c(C(=O)Nc2cnccc2C(=O)OCC)cc1O |
| InChI | InChI=1S/C18H18N2O7/c1-3-26-17(24)10-5-6-19-9-13(10)20-16(23)11-7-15(22)12(8-14(11)21)18(25)27-4-2/h5-9,21-22H,3-4H2,1-2H3,(H,20,23) |
| InChIKey | RIVATOQEQDXOIC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|