C14H18FNO2 — CID 156768350
1-[4-(1,3-dioxol-2-yl)-3-fluorophenyl]-3-methylbutan-2-amine (PubChem CID 156768350) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-[4-(1,3-dioxol-2-yl)-3-fluorophenyl]-3-methylbutan-2-amine.
| Compound Name | 1-[4-(1,3-dioxol-2-yl)-3-fluorophenyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 156768350 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-[4-(1,3-dioxol-2-yl)-3-fluorophenyl]-3-methylbutan-2-amine |
| SMILES | CC(C)C(N)Cc1ccc(C2OC=CO2)c(F)c1 |
| InChI | InChI=1S/C14H18FNO2/c1-9(2)13(16)8-10-3-4-11(12(15)7-10)14-17-5-6-18-14/h3-7,9,13-14H,8,16H2,1-2H3 |
| InChIKey | DFPFYPIYZWZDJK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |