C15H24O2 — CID 156769250
3,5-diethoxypentylbenzene (PubChem CID 156769250) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 3,5-diethoxypentylbenzene.
| Compound Name | 3,5-diethoxypentylbenzene |
|---|---|
| PubChem CID | 156769250 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3,5-diethoxypentylbenzene |
| SMILES | CCOCCC(CCc1ccccc1)OCC |
| InChI | InChI=1S/C15H24O2/c1-3-16-13-12-15(17-4-2)11-10-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3 |
| InChIKey | RKLVPJHXGDDAOE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|