C20H17N7O — CID 156770236
1-pyridin-3-yl-3-[7-(pyridin-3-ylmethylamino)quinazolin-2-yl]urea (PubChem CID 156770236) has the molecular formula C20H17N7O and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-[7-(pyridin-3-ylmethylamino)quinazolin-2-yl]urea.
| Compound Name | 1-pyridin-3-yl-3-[7-(pyridin-3-ylmethylamino)quinazolin-2-yl]urea |
|---|---|
| PubChem CID | 156770236 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-pyridin-3-yl-3-[7-(pyridin-3-ylmethylamino)quinazolin-2-yl]urea |
| SMILES | O=C(Nc1cccnc1)Nc1ncc2ccc(NCc3cccnc3)cc2n1 |
| InChI | InChI=1S/C20H17N7O/c28-20(25-17-4-2-8-22-13-17)27-19-24-12-15-5-6-16(9-18(15)26-19)23-11-14-3-1-7-21-10-14/h1-10,12-13,23H,11H2,(H2,24,25,26,27,28) |
| InChIKey | HFZLSBYKNUOHPL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |