C16H12O3Se — CID 156771931
(E)-3-[2-(3-hydroxy-7-selenabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)-4-methoxyphenyl]prop-2-enal (PubChem CID 156771931) has the molecular formula C16H12O3Se and a molecular weight of 331.23 g/mol. Its IUPAC name is (E)-3-[2-(3-hydroxy-7-selenabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)-4-methoxyphenyl]prop-2-enal.
| Compound Name | (E)-3-[2-(3-hydroxy-7-selenabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)-4-methoxyphenyl]prop-2-enal |
|---|---|
| PubChem CID | 156771931 |
| Molecular Formula | C16H12O3Se |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | (E)-3-[2-(3-hydroxy-7-selenabicyclo[4.1.0]hepta-1(6),2,4-trien-2-yl)-4-methoxyphenyl]prop-2-enal |
| SMILES | COc1ccc(/C=C/C=O)c(-c2c(O)ccc3c2[Se]3)c1 |
| InChI | InChI=1S/C16H12O3Se/c1-19-11-5-4-10(3-2-8-17)12(9-11)15-13(18)6-7-14-16(15)20-14/h2-9,18H,1H3/b3-2+ |
| InChIKey | PSHRMDVMPDXEJM-NSCUHMNNSA-N |
| XLogP | 1.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|