About sodium dodecan-6-yloxysulfonyl sulfate
sodium dodecan-6-yloxysulfonyl sulfate (PubChem CID 156772479) has the molecular formula C12H25NaO7S2
and a molecular weight of 368.45 g/mol. Its IUPAC name is sodium dodecan-6-yloxysulfonyl sulfate.
Molecular Properties
| Compound Name | sodium dodecan-6-yloxysulfonyl sulfate |
| PubChem CID | 156772479 |
| Molecular Formula | C12H25NaO7S2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | sodium dodecan-6-yloxysulfonyl sulfate |
| SMILES | CCCCCCC(CCCCC)OS(=O)(=O)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H26O7S2.Na/c1-3-5-7-9-11-12(10-8-6-4-2)18-21(16,17)19-20(13,14)15;/h12H,3-11H2,1-2H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | BFXFTHNBCLUZBT-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium dodecan-6-yloxysulfonyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dodecan-6-yloxysulfonyl sulfate?
The IUPAC name of sodium dodecan-6-yloxysulfonyl sulfate (CID 156772479) is sodium dodecan-6-yloxysulfonyl sulfate.
What is the SMILES notation for sodium dodecan-6-yloxysulfonyl sulfate?
The canonical SMILES for sodium dodecan-6-yloxysulfonyl sulfate is CCCCCCC(CCCCC)OS(=O)(=O)OS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium dodecan-6-yloxysulfonyl sulfate?
The InChIKey is BFXFTHNBCLUZBT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H26O7S2.Na/c1-3-5-7-9-11-12(10-8-6-4-2)18-21(16,17)19-20(13,14)15;/h12H,3-11H2,1-2H3,(H,13,14,15);/q;+1/p-1.
What are the key properties of sodium dodecan-6-yloxysulfonyl sulfate?
sodium dodecan-6-yloxysulfonyl sulfate has a molecular weight of 368.45 g/mol, XLogP of -0.35, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dodecan-6-yloxysulfonyl sulfate is sourced from PubChem (CID 156772479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).