C8H14ClNO3 — CID 15677270
(2R)-2-[(2-chloroacetyl)-methylamino]-3-methylbutanoic acid (PubChem CID 15677270) has the molecular formula C8H14ClNO3 and a molecular weight of 207.66 g/mol. Its IUPAC name is (2R)-2-[(2-chloroacetyl)-methylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2-chloroacetyl)-methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 15677270 |
| Molecular Formula | C8H14ClNO3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2R)-2-[(2-chloroacetyl)-methylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)N(C)C(=O)CCl |
| InChI | InChI=1S/C8H14ClNO3/c1-5(2)7(8(12)13)10(3)6(11)4-9/h5,7H,4H2,1-3H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | SOIJQISVJHVQRE-SSDOTTSWSA-N |
| XLogP | 0.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|