fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid

C7H12FmNO3- — CID 166481876

IUPACfermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid
SMILESCC(C)C(C(=O)O)N(C)[C-]=O.[Fm]
InChIInChI=1S/C7H12NO3.Fm/c1-5(2)6(7(10)11)8(3)4-9;/h5-6H,1-3H3,(H,10,11);/q-1;
InChIKeyWXAMPMNYFFGABK-UHFFFAOYSA-N
MW415.18 g/mol
LogP0.09
Rot. Bonds4

About fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid

fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid (PubChem CID 166481876) has the molecular formula C7H12FmNO3- and a molecular weight of 415.18 g/mol. Its IUPAC name is fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid.

Molecular Properties

Compound Namefermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid
PubChem CID166481876
Molecular FormulaC7H12FmNO3-
Molecular Weight415.18 g/mol
Exact Mass415.18
IUPAC Namefermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid
SMILESCC(C)C(C(=O)O)N(C)[C-]=O.[Fm]
InChIInChI=1S/C7H12NO3.Fm/c1-5(2)6(7(10)11)8(3)4-9;/h5-6H,1-3H3,(H,10,11);/q-1;
InChIKeyWXAMPMNYFFGABK-UHFFFAOYSA-N
XLogP0.09
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500415.18
LogP ≤ 50.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}

Analyze fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid?
The IUPAC name of fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid (CID 166481876) is fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid.
What is the SMILES notation for fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid?
The canonical SMILES for fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid is CC(C)C(C(=O)O)N(C)[C-]=O.[Fm].
What is the InChIKey of fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid?
The InChIKey is WXAMPMNYFFGABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12NO3.Fm/c1-5(2)6(7(10)11)8(3)4-9;/h5-6H,1-3H3,(H,10,11);/q-1;.
What are the key properties of fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid?
fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid has a molecular weight of 415.18 g/mol, XLogP of 0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fermium;3-methyl-2-[methyl(oxomethyl)amino]butanoic acid is sourced from PubChem (CID 166481876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).