C6H13NO3 — CID 131877082
(2R,3R)-2-(dimethylamino)-3-hydroxybutanoic acid (PubChem CID 131877082) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is (2R,3R)-2-(dimethylamino)-3-hydroxybutanoic acid.
| Compound Name | (2R,3R)-2-(dimethylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 131877082 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (2R,3R)-2-(dimethylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](C(=O)O)N(C)C |
| InChI | InChI=1S/C6H13NO3/c1-4(8)5(6(9)10)7(2)3/h4-5,8H,1-3H3,(H,9,10)/t4-,5-/m1/s1 |
| InChIKey | CIVVRPHZRYVSCF-RFZPGFLSSA-N |
| XLogP | -0.62 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |