C9H15NO3 — CID 174368010
2-[cyclobuten-1-yl(methyl)amino]-3-hydroxybutanoic acid (PubChem CID 174368010) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-[cyclobuten-1-yl(methyl)amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[cyclobuten-1-yl(methyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 174368010 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-[cyclobuten-1-yl(methyl)amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(C(=O)O)N(C)C1=CCC1 |
| InChI | InChI=1S/C9H15NO3/c1-6(11)8(9(12)13)10(2)7-4-3-5-7/h4,6,8,11H,3,5H2,1-2H3,(H,12,13) |
| InChIKey | QEBFWQSSGOMLAH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |