C12H23N3O7 — CID 87844230
2-[bis(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoic acid (PubChem CID 87844230) has the molecular formula C12H23N3O7 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[bis(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[bis(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 87844230 |
| Molecular Formula | C12H23N3O7 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[bis(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(N)C(=O)N(C(=O)C(N)C(C)O)C(C(=O)O)C(C)O |
| InChI | InChI=1S/C12H23N3O7/c1-4(16)7(13)10(19)15(9(6(3)18)12(21)22)11(20)8(14)5(2)17/h4-9,16-18H,13-14H2,1-3H3,(H,21,22) |
| InChIKey | NVRAGKPOYGQMDH-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |