C7H13IN2O5 — CID 175868068
(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]-iodoamino]-3-hydroxypropanoic acid (PubChem CID 175868068) has the molecular formula C7H13IN2O5 and a molecular weight of 332.09 g/mol. Its IUPAC name is (2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]-iodoamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]-iodoamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175868068 |
| Molecular Formula | C7H13IN2O5 |
| Molecular Weight | 332.09 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | (2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]-iodoamino]-3-hydroxypropanoic acid |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N(I)[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H13IN2O5/c1-3(12)5(9)6(13)10(8)4(2-11)7(14)15/h3-5,11-12H,2,9H2,1H3,(H,14,15)/t3-,4+,5+/m1/s1 |
| InChIKey | QSDLCBVPCAZIBP-WISUUJSJSA-N |
| XLogP | -1.68 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.09 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|