C14H23NO — CID 156773045
N-(2,3-dimethylcyclopropyl)-N-octa-2,6-dienylformamide (PubChem CID 156773045) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopropyl)-N-octa-2,6-dienylformamide.
| Compound Name | N-(2,3-dimethylcyclopropyl)-N-octa-2,6-dienylformamide |
|---|---|
| PubChem CID | 156773045 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(2,3-dimethylcyclopropyl)-N-octa-2,6-dienylformamide |
| SMILES | CC=CCCC=CCN(C=O)C1C(C)C1C |
| InChI | InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-15(11-16)14-12(2)13(14)3/h4-5,8-9,11-14H,6-7,10H2,1-3H3 |
| InChIKey | HEOVDGIGDAVAFP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|