C15H25NO2 — CID 123405363
2-[methyl(octa-2,6-dienyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 123405363) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[methyl(octa-2,6-dienyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[methyl(octa-2,6-dienyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123405363 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-[methyl(octa-2,6-dienyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)CC=CCCC=CC |
| InChI | InChI=1S/C15H25NO2/c1-5-6-7-8-9-10-11-16(4)12-13-18-15(17)14(2)3/h5-6,9-10H,2,7-8,11-13H2,1,3-4H3 |
| InChIKey | ASXPUCHOVDKGRB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|