C22H21OP — CID 156774876
[[(1E)-1-cyclopenta-2,4-dien-1-yl-3-methylbuta-1,3-dienyl]-phenylphosphoryl]benzene (PubChem CID 156774876) has the molecular formula C22H21OP and a molecular weight of 332.38 g/mol. Its IUPAC name is [[(1E)-1-cyclopenta-2,4-dien-1-yl-3-methylbuta-1,3-dienyl]-phenylphosphoryl]benzene.
| Compound Name | [[(1E)-1-cyclopenta-2,4-dien-1-yl-3-methylbuta-1,3-dienyl]-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 156774876 |
| Molecular Formula | C22H21OP |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [[(1E)-1-cyclopenta-2,4-dien-1-yl-3-methylbuta-1,3-dienyl]-phenylphosphoryl]benzene |
| SMILES | C=C(C)/C=C(\C1C=CC=C1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21OP/c1-18(2)17-22(19-11-9-10-12-19)24(23,20-13-5-3-6-14-20)21-15-7-4-8-16-21/h3-17,19H,1H2,2H3/b22-17+ |
| InChIKey | SDWJLRYXHVCQAY-OQKWZONESA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|