C3N3O9P5 — CID 156775910
4-[cyano-[(4-cyano-4-oxo-1,3,2,4λ5-dioxadiphosphetan-2-yl)oxy]phosphoryl]oxy-2-oxo-1,3,2λ5,4-dioxadiphosphetane-2-carbonitrile (PubChem CID 156775910) has the molecular formula C3N3O9P5 and a molecular weight of 376.92 g/mol. Its IUPAC name is 4-[cyano-[(4-cyano-4-oxo-1,3,2,4λ5-dioxadiphosphetan-2-yl)oxy]phosphoryl]oxy-2-oxo-1,3,2λ5,4-dioxadiphosphetane-2-carbonitrile.
| Compound Name | 4-[cyano-[(4-cyano-4-oxo-1,3,2,4λ5-dioxadiphosphetan-2-yl)oxy]phosphoryl]oxy-2-oxo-1,3,2λ5,4-dioxadiphosphetane-2-carbonitrile |
|---|---|
| PubChem CID | 156775910 |
| Molecular Formula | C3N3O9P5 |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.83 |
| IUPAC Name | 4-[cyano-[(4-cyano-4-oxo-1,3,2,4λ5-dioxadiphosphetan-2-yl)oxy]phosphoryl]oxy-2-oxo-1,3,2λ5,4-dioxadiphosphetane-2-carbonitrile |
| SMILES | N#CP1(=O)OP(OP(=O)(C#N)OP2OP(=O)(C#N)O2)O1 |
| InChI | InChI=1S/C3N3O9P5/c4-1-18(7)10-16(11-18)14-20(9,3-6)15-17-12-19(8,2-5)13-17 |
| InChIKey | DMXNWERLRDELGH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 177.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|