C21H23NO2 — CID 156776205
4-(3,5-dicyclopropyl-N-methylanilino)-2-methylbenzoic acid (PubChem CID 156776205) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(3,5-dicyclopropyl-N-methylanilino)-2-methylbenzoic acid.
| Compound Name | 4-(3,5-dicyclopropyl-N-methylanilino)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 156776205 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-(3,5-dicyclopropyl-N-methylanilino)-2-methylbenzoic acid |
| SMILES | Cc1cc(N(C)c2cc(C3CC3)cc(C3CC3)c2)ccc1C(=O)O |
| InChI | InChI=1S/C21H23NO2/c1-13-9-18(7-8-20(13)21(23)24)22(2)19-11-16(14-3-4-14)10-17(12-19)15-5-6-15/h7-12,14-15H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | VQFGMZOTWMBDGW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |