C21H22FNO2 — CID 156776239
methyl 4-(3,5-dicyclopropyl-N-methylanilino)-2-fluorobenzoate (PubChem CID 156776239) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is methyl 4-(3,5-dicyclopropyl-N-methylanilino)-2-fluorobenzoate.
| Compound Name | methyl 4-(3,5-dicyclopropyl-N-methylanilino)-2-fluorobenzoate |
|---|---|
| PubChem CID | 156776239 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl 4-(3,5-dicyclopropyl-N-methylanilino)-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(N(C)c2cc(C3CC3)cc(C3CC3)c2)cc1F |
| InChI | InChI=1S/C21H22FNO2/c1-23(17-7-8-19(20(22)12-17)21(24)25-2)18-10-15(13-3-4-13)9-16(11-18)14-5-6-14/h7-14H,3-6H2,1-2H3 |
| InChIKey | NQNXXJXTOFIXGR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |