C15H18FNO2 — CID 176578719
methyl 4-(8-azabicyclo[3.2.1]octan-3-yl)-2-fluorobenzoate (PubChem CID 176578719) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is methyl 4-(8-azabicyclo[3.2.1]octan-3-yl)-2-fluorobenzoate.
| Compound Name | methyl 4-(8-azabicyclo[3.2.1]octan-3-yl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 176578719 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl 4-(8-azabicyclo[3.2.1]octan-3-yl)-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(C2CC3CCC(C2)N3)cc1F |
| InChI | InChI=1S/C15H18FNO2/c1-19-15(18)13-5-2-9(8-14(13)16)10-6-11-3-4-12(7-10)17-11/h2,5,8,10-12,17H,3-4,6-7H2,1H3 |
| InChIKey | LYBAFMILNYHBPR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |