C19H18F3N3O2 — CID 156777511
[4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methylamino]pyrazol-3-yl]phenyl]methanol (PubChem CID 156777511) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is [4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methylamino]pyrazol-3-yl]phenyl]methanol.
| Compound Name | [4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methylamino]pyrazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 156777511 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methylamino]pyrazol-3-yl]phenyl]methanol |
| SMILES | Cn1nc(-c2ccc(CO)cc2)cc1NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-25-18(10-17(24-25)15-6-2-14(12-26)3-7-15)23-11-13-4-8-16(9-5-13)27-19(20,21)22/h2-10,23,26H,11-12H2,1H3 |
| InChIKey | QZZCFWNHWNHKRK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |