C24H23ClF3NO — CID 59820940
N-[(4-tert-butylphenyl)methyl]-4-chloro-2-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 59820940) has the molecular formula C24H23ClF3NO and a molecular weight of 433.90 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-4-chloro-2-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-4-chloro-2-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 59820940 |
| Molecular Formula | C24H23ClF3NO |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-4-chloro-2-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CC(C)(C)c1ccc(CNc2ccc(Cl)cc2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H23ClF3NO/c1-23(2,3)18-8-4-16(5-9-18)15-29-22-13-10-19(25)14-21(22)17-6-11-20(12-7-17)30-24(26,27)28/h4-14,29H,15H2,1-3H3 |
| InChIKey | VBMJSUOYRDITIS-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |