C27H30F3NO2 — CID 59820876
N-[(4-tert-butylphenyl)methyl]-4-propoxy-3-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 59820876) has the molecular formula C27H30F3NO2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-4-propoxy-3-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-4-propoxy-3-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 59820876 |
| Molecular Formula | C27H30F3NO2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-4-propoxy-3-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CCCOc1ccc(NCc2ccc(C(C)(C)C)cc2)cc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H30F3NO2/c1-5-16-32-25-15-12-22(31-18-19-6-10-21(11-7-19)26(2,3)4)17-24(25)20-8-13-23(14-9-20)33-27(28,29)30/h6-15,17,31H,5,16,18H2,1-4H3 |
| InChIKey | YAXRLWSTJUQJNH-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|