C35H38N4O3S — CID 156778003
4-[1-[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide (PubChem CID 156778003) has the molecular formula C35H38N4O3S and a molecular weight of 594.78 g/mol. Its IUPAC name is 4-[1-[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide.
| Compound Name | 4-[1-[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide |
|---|---|
| PubChem CID | 156778003 |
| Molecular Formula | C35H38N4O3S |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 4-[1-[3-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-1-methylcyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-N,N,2-trimethylbenzamide |
| SMILES | Cc1cc(-c2cn(S(=O)(=O)C3(C)C=C(c4cc(C)c5c(c4)CN(C)CC5)C=CC3)c3ncccc23)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C35H38N4O3S/c1-23-18-27(19-28-21-38(6)16-13-29(23)28)26-9-7-14-35(3,20-26)43(41,42)39-22-32(31-10-8-15-36-33(31)39)25-11-12-30(24(2)17-25)34(40)37(4)5/h7-12,15,17-20,22H,13-14,16,21H2,1-6H3 |
| InChIKey | KMMPXGBXFCSFQU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |