C26H29N5O5 — CID 156779697
tert-butyl N-[(3R)-1-[(5-hydroxy-1,3,2-benzodioxazol-6-yl)-(5-pyridin-4-yl-2-pyridinyl)methyl]pyrrolidin-3-yl]carbamate (PubChem CID 156779697) has the molecular formula C26H29N5O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(5-hydroxy-1,3,2-benzodioxazol-6-yl)-(5-pyridin-4-yl-2-pyridinyl)methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(5-hydroxy-1,3,2-benzodioxazol-6-yl)-(5-pyridin-4-yl-2-pyridinyl)methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 156779697 |
| Molecular Formula | C26H29N5O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(5-hydroxy-1,3,2-benzodioxazol-6-yl)-(5-pyridin-4-yl-2-pyridinyl)methyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C(c2ccc(-c3ccncc3)cn2)c2cc3c(cc2O)ONO3)C1 |
| InChI | InChI=1S/C26H29N5O5/c1-26(2,3)34-25(33)29-18-8-11-31(15-18)24(19-12-22-23(13-21(19)32)36-30-35-22)20-5-4-17(14-28-20)16-6-9-27-10-7-16/h4-7,9-10,12-14,18,24,30,32H,8,11,15H2,1-3H3,(H,29,33)/t18-,24?/m1/s1 |
| InChIKey | SFEKSWHIESHTED-QFADGXAASA-N |
| XLogP | 3.73 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|